Xanthohumol | Appearance | Solid |
| CAS | 6754-58-1 |
| Purity | 99.97% |
| Molecular Weight | 354.40 |
| Formula | C21H22O5 |
| Color | Yellow to orange |
| SMILES | O=C(C1=C(OC)C=C(O)C(C/C=C(C)\C)=C1O)/C=C/C2=CC=C(O)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19159 | Qianhucoumarin C | Inquiry |
|
| PDP-15096 | Cinnamtannin B-1 | Inquiry |
|
| PDP-19538 | Logmalicid B | Inquiry |
|
| PDP-15262 | Ganoderic Acid G | Inquiry |
|
| PDP-13791 | 1,3,5-Trimethoxybenzene | Inquiry |
|
| PDP-14391 | Pennogenin 3-O-beta-chacotrioside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
