Xanthoquinodin A1 | CAS No. | 151063-27-3 |
| Molecular Weight | 572.52 |
| Formula | C31H24O11 |
| SMILES | O=C(C1=CC(C)=CC(O)=C21)[C@@]3(CC4=CC(O[C@]5([C@H](CC6)O)C(OC)=O)=C(C(C5=C6O)=O)C(O)=C4[C@@H]7C=C3)C(C2=O)=C7O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12577 | Beauverolide Ka | Inquiry |
|
| MDP-11281 | Penicillin G Sodium Salt | Inquiry |
|
| MDP-23897 | Clavamycin B | Inquiry |
|
| MDP-11942 | Lincomycin | Inquiry |
|
| MDP-22760 | Harzianoside B | Inquiry |
|
| MDP-24120 | Phoslactomycin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
