(Z)-Ganoderenic Acid D | CAS No. | 1910062-63-3 |
| Molecular Weight | 512.63 |
| Formula | C30H40O7 |
| SMILES | C[C@]12C3=C(C(C[C@@]1([C@H](CC2=O)/C(C)=C\C(C[C@@H](C)C(O)=O)=O)C)=O)[C@@]4([C@@](C(C)(C(CC4)=O)C)([H])C[C@@H]3O)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24301 | Herbicidin B | Inquiry |
|
| MDP-23353 | Aureusimine B | Inquiry |
|
| MDP-24156 | Resorthiomycin | Inquiry |
|
| MDP-11074 | L-Homocysteine | Inquiry |
|
| MDP-11942 | Lincomycin | Inquiry |
|
| MDP-12520 | Demethoxyrapamycin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
