Ziyuglycoside I | Appearance | Solid |
| CAS | 35286-58-9 |
| Purity | 99.42% |
| Molecular Weight | 766.96 |
| Formula | C41H66O13 |
| Color | White to off-white |
| SMILES | O[C@@H]1[C@@H](O)[C@]([H])(O[C@@H]2C(C)(C)[C@@](CC[C@]3(C)[C@]4([H])CC=C5[C@@]3(C)CC[C@]6(C(O[C@H]7[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O7)=O)[C@@]5([H])[C@@](O)(C)[C@H](C)CC6)([H])[C@]4(C)CC2)OC[C@@H]1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20011 | 1-Nonadecanol (Standard) | Inquiry |
|
| PDP-15175 | Helicin | Inquiry |
|
| PDP-19374 | Taxacin | Inquiry |
|
| PDP-15855 | Asiaticoside B | Inquiry |
|
| PDP-17545 | Triptoquinone B | Inquiry |
|
| PDP-14966 | Datiscetin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
