1-Hydroxyauramycin B | CAS No. | 79206-72-7 |
| Molecular Weight | 811.82 |
| Formula | C41H49NO16 |
| SMILES | O=C1C2=C(C(C3=C1C(O)=CC=C3O)=O)C(O)=C([C@@H](O[C@@H]4OC([C@H](C(C4)N(C)C)O[C@@H]5O[C@H](C6OC7O[C@@H](C)C(CC7OC6C5)=O)C)C)CC(C)(C8C(OC)=O)O)C8=C2 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11802 | Pyrithiamine Hydrobromide | Inquiry |
|
| MDP-23871 | Elsamicin B | Inquiry |
|
| MDP-10969 | L-Lactic Acid | Inquiry |
|
| MDP-22817 | Hydroxysulochrin | Inquiry |
|
| MDP-23873 | Hydroxymycotrienin A | Inquiry |
|
| MDP-12089 | Inosinic Acid (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
