1-Methoxyphaseollidin | Appearance | Solid |
| CAS | 65428-13-9 |
| Purity | 99.11% |
| Molecular Weight | 354.40 |
| Formula | C21H22O5 |
| Color | White to off-white |
| SMILES | OC1=CC(OC)=C2[C@@](OC3=C(C/C=C(C)\C)C(O)=CC=C34)([H])[C@@]4([H])COC2=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17467 | Physagulide J | Inquiry |
|
| PDP-17006 | Kihadanin B | Inquiry |
|
| PDP-13157 | Norepinephrine Hydrochloride | Inquiry |
|
| PDP-18727 | 8-Methyl Chrysophanol | Inquiry |
|
| PDP-16913 | Cussosaponin C | Inquiry |
|
| PDP-17065 | Yadanzioside M | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
