8-Methyl Chrysophanol | Synonyms | Chrysophanol 8-methyl Ether |
| CAS | 3300-25-2 |
| Molecular Weight | 268.26 |
| Formula | C16H12O4 |
| SMILES | O=C1C2=C(C=CC=C2OC)C(C3=CC(C)=CC(O)=C13)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16564 | 2-Methylpyrazine | Inquiry |
|
| PDP-13460 | OSW-1 | Inquiry |
|
| PDP-15206 | Cyclo(Gly-L-Pro) | Inquiry |
|
| PDP-14339 | Aristolochic Acid B | Inquiry |
|
| PDP-19434 | Procumbide | Inquiry |
|
| PDP-14981 | Peruvoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.