10-Hydroxyaloin B | Appearance | Solid |
| CAS | 134863-92-6 |
| Purity | 99.90% |
| Molecular Weight | 434.39 |
| Formula | C21H22O10 |
| Color | Light yellow to yellow |
| SMILES | O[C@]1([C@]2([H])O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)C3=CC(CO)=CC(O)=C3C(C4=C(O)C=CC=C41)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14392 | Hirsuteine | Inquiry |
|
| PDP-13281 | Butylphthalide | Inquiry |
|
| PDP-17017 | Butyrospermol | Inquiry |
|
| PDP-13379 | Polyphyllin I | Inquiry |
|
| PDP-18092 | 16α-Hydroxydehydrotrametenolic Acid | Inquiry |
|
| PDP-19000 | Triptinin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
