Triptinin B | CAS | 189389-05-7 |
| Molecular Weight | 314.42 |
| Formula | C20H26O3 |
| SMILES | O=C(C1=C(C)[C@]2([H])CCC3=C(C=CC(C(C)C)=C3O)[C@@]2(C)CC1)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17473 | 1-Methoxymethyl-β-carboline | Inquiry |
|
| PDP-16907 | Raddeanoside R8 | Inquiry |
|
| PDP-19385 | Pterisolic Acid F | Inquiry |
|
| PDP-17497 | Anhuienside F | Inquiry |
|
| PDP-18464 | Glabrolide | Inquiry |
|
| PDP-14425 | Callistephin Chloride | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
