10-Methoxycamptothecin (Standard) | CAS | 19685-10-0 |
| Molecular Weight | 378.38 |
| Formula | C21H18N2O5 |
| SMILES | O=C1[C@](O)(CC)C2=C(CO1)C(N3CC4=CC5=CC(OC)=CC=C5N=C4C3=C2)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15142 | Euscaphic Acid | Inquiry |
|
| PDP-17267 | 11-Oxo-α-amyrin | Inquiry |
|
| PDP-17077 | Volvaltrate B | Inquiry |
|
| PDP-17587 | 8-Demethoxycephatonine | Inquiry |
|
| PDP-14086 | Acridone | Inquiry |
|
| PDP-14475 | Marrubiin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
