Volvaltrate B | CAS | 1181224-13-4 |
| Molecular Weight | 577.06 |
| Formula | C27H41ClO11 |
| SMILES | CC(C)[C@@H](OC(CC(C)C)=O)C(OCC1=CO[C@@H](OC(CC(C)C)=O)[C@@]2([H])[C@]1(O)C[C@H](OC(C)=O)[C@@]2(CCl)O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17877 | 4-Aminophenyl 6-deoxy-α-L-mannopyranoside | Inquiry |
|
| PDP-18452 | 4"-methyloxy-Daidzin | Inquiry |
|
| PDP-18955 | Brevicornin | Inquiry |
|
| PDP-15603 | Dihydropalmatine | Inquiry |
|
| PDP-14409 | Jolkinolide B | Inquiry |
|
| PDP-18931 | Pungiolide A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
