11α-O-Tigloyl-12β-O-acetyltenacigenin B | CAS | 154022-51-2 |
| Molecular Weight | 488.61 |
| Formula | C28H40O7 |
| SMILES | C[C@@]12[C@]3(CC[C@H]2C(C)=O)[C@]4([C@]([C@@]5([C@@](C[C@H](CC5)O)([H])CC4)C)([H])[C@@H]([C@H]1OC(C)=O)OC(/C(C)=C/C)=O)O3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14662 | Makisterone A | Inquiry |
|
| PDP-19065 | Echitoveniline | Inquiry |
|
| PDP-15656 | 11-Deoxymogroside V | Inquiry |
|
| PDP-16449 | Chrysin (Standard) | Inquiry |
|
| PDP-17166 | Ficusonolide | Inquiry |
|
| PDP-17742 | Diosgenin-3-O-rhamnosyl(1→2)[glucosyl(1→6)]glucoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
