Ficusonolide | CAS | 1800503-81-4 |
| Molecular Weight | 454.68 |
| Formula | C30H46O3 |
| SMILES | O=C1[C@@]23[C@]([C@@H](C(C)(CC3)C)O1)([H])C4=CC[C@@]([C@@]5([C@@](C(C)([C@@H](CC5)O)C)([H])CC6)C)([H])[C@]6(C)[C@@]4(CC2)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17337 | Neobritannilactone B | Inquiry |
|
| PDP-19404 | 22-Dehydroclerosterol | Inquiry |
|
| PDP-17646 | Antioxidant Agent-10 | Inquiry |
|
| PDP-18270 | Cassyfiline | Inquiry |
|
| PDP-17628 | Salvifaricin | Inquiry |
|
| PDP-15666 | Manassantin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
