13-Hydroxyisobakuchiol | Synonyms | Delta3,2-Hydroxylbakuchiol |
| CAS | 178765-49-6 |
| Molecular Weight | 272.38 |
| Formula | C18H24O2 |
| SMILES | OC1=CC=C(/C=C/[C@](C)(C=C)C/C=C/C(C)(O)C)C=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13172 | Asiaticoside | Inquiry |
|
| PDP-15734 | N-Oleoyl Alanine | Inquiry |
|
| PDP-15239 | Isomangiferin | Inquiry |
|
| PDP-17583 | 16β-Hydroperoxyalisol B 23-acetate | Inquiry |
|
| PDP-16102 | Erysubin B | Inquiry |
|
| PDP-17309 | Angulatin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
