Isomangiferin | Appearance | Solid |
| CAS | 24699-16-9 |
| Purity | 99.82% |
| Molecular Weight | 422.34 |
| Formula | C19H18O11 |
| Color | Light yellow to green yellow |
| SMILES | OC1=CC(O)=C2C(OC3=CC(O)=C(O)C=C3C2=O)=C1[C@@H]([C@@H]([C@@H](O)[C@@H]4O)O)O[C@@H]4CO |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15988 | Epiberberine | Inquiry |
|
| PDP-15807 | L-5-Hydroxytryptophan (Standard) | Inquiry |
|
| PDP-17932 | 1α-Hydroxytorilin | Inquiry |
|
| PDP-19823 | Alisol B 23-acetate (Standard) | Inquiry |
|
| PDP-14298 | Poricoic Acid B | Inquiry |
|
| PDP-14300 | Humulone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
