1,6,7-Trihydroxyxanthone | CAS | 25577-04-2 |
| Molecular Weight | 244.20 |
| Formula | C13H8O5 |
| SMILES | O=C1C2=C(OC3=C1C=C(O)C(O)=C3)C=CC=C2O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19839 | Vasicinone (Standard) | Inquiry |
|
| PDP-19684 | Sennidin B (Standard) | Inquiry |
|
| PDP-18979 | Lutein Dipalmitate | Inquiry |
|
| PDP-14056 | Cyanidin-3-O-galactoside Chloride | Inquiry |
|
| PDP-18202 | Caffeoxylupeol | Inquiry |
|
| PDP-17336 | (2S)-4'-Hydroxy-7-methoxyflavan | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
