Vasicinone (Standard) | CAS | 486-64-6 |
| Molecular Weight | 202.21 |
| Formula | C11H10N2O2 |
| SMILES | O=C1N2C([C@@H](O)CC2)=NC3=C1C=CC=C3 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16724 | Nortrachelogenin | Inquiry |
|
| PDP-14595 | Cichoriin | Inquiry |
|
| PDP-19251 | Astin B | Inquiry |
|
| PDP-18103 | Pierreione B | Inquiry |
|
| PDP-16741 | trans-3,5-Dimethoxystilbene | Inquiry |
|
| PDP-18877 | Anigorufone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
