(19Z)-Normacusine B | CAS | 124096-81-7 |
| Molecular Weight | 294.39 |
| Formula | C19H22N2O |
| SMILES | OC[C@H]1[C@@]2([H])[N@@](C/3)[C@](C[C@H]1C3=C\C)([H])C4=C(C2)C5=CC=CC=C5N4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13434 | Diacerein | Inquiry |
|
| PDP-19515 | Heteroclitin I | Inquiry |
|
| PDP-19174 | Hedysarimcoumestan B | Inquiry |
|
| PDP-19101 | Cathayanon H | Inquiry |
|
| PDP-14939 | Hydroquinine | Inquiry |
|
| PDP-14592 | Djalonensone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
