2-Deoxokanshone M | Synonyms | Nardosinone Acid |
| CAS | 53859-07-7 |
| Molecular Weight | 192.25 |
| Formula | C12H16O2 |
| SMILES | C[C@@]12C(C(CC(C2)=O)=O)=CCC[C@H]1C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14924 | Aegeline | Inquiry |
|
| PDP-16107 | Ilicic Acid | Inquiry |
|
| PDP-15097 | Guaijaverin | Inquiry |
|
| PDP-14068 | Cedrol | Inquiry |
|
| PDP-17458 | Vellosimine | Inquiry |
|
| PDP-14593 | Ganoderic Acid B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
