2,2':5',2"-Terthiophene | Synonyms | α-Terthiophene; α-Terthienyl; Trithiophene |
| Appearance | Solid |
| CAS | 1081-34-1 |
| Purity | 99.59% |
| Molecular Weight | 248.40 |
| Formula | C12H8S3 |
| Color | Light yellow to yellow |
| SMILES | C1(C2=CC=C(C3=CC=CS3)S2)=CC=CS1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19768 | Phillyrin (Standard) | Inquiry |
|
| PDP-13109 | Capsaicin | Inquiry |
|
| PDP-19821 | Tenuigenin (Standard) | Inquiry |
|
| PDP-18793 | Methyl Kakuol | Inquiry |
|
| PDP-19824 | Chikusetsusaponin Iva (Standard) | Inquiry |
|
| PDP-14755 | 5-O-Demethylnobiletin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
