2α,3α,24-Trihydroxyolean-12-en-28-oic Acid | CAS | 150821-16-2 |
| Molecular Weight | 488.70 |
| Formula | C30H48O5 |
| SMILES | C[C@]12[C@]3(C([C@@]4([H])[C@@](CC3)(CCC(C)(C4)C)C(O)=O)=CC[C@]1([H])[C@@]5([C@@]([C@](C)([C@@H]([C@@H](C5)O)O)CO)([H])CC2)C)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18401 | 1-(26-Hydroxyhexacosanoyl)-glycerol | Inquiry |
|
| PDP-19294 | Interiorin C | Inquiry |
|
| PDP-19509 | Lignan J1 | Inquiry |
|
| PDP-14393 | Heterophyllin B | Inquiry |
|
| PDP-18128 | Nyasicol | Inquiry |
|
| PDP-17714 | 5-Hydroxy-2-[2-(2-hydroxyphenyl)ethyl]chromone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
