5-Hydroxy-2-[2-(2-hydroxyphenyl)ethyl]chromone | CAS | 357637-15-1 |
| Molecular Weight | 282.29 |
| Formula | C17H14O4 |
| SMILES | O=C1C=C(CCC2=C(O)C=CC=C2)OC3=C1C(O)=CC=C3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19135 | Furostan, β-D-glucopyranoside Deriv | Inquiry |
|
| PDP-13724 | Ellipticine Hydrochloride | Inquiry |
|
| PDP-16335 | Cnidilin | Inquiry |
|
| PDP-16247 | Chlojaponilactone B | Inquiry |
|
| PDP-16606 | 3-tert-Butyl-4-methoxyphenol | Inquiry |
|
| PDP-17530 | Solidagonic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
