2,3,5,4'-Tetrahydroxystilbene 2-O-β-D-glucoside (Standard) | Appearance | Solid |
| CAS | 82373-94-2 |
| Molecular Weight | 406.39 |
| Formula | C20H22O9 |
| Color | Light yellow to yellow |
| SMILES | OC1=CC(O)=CC(/C=C/C2=CC=C(O)C=C2)=C1O[C@@H]([C@@H]([C@@H](O)[C@@H]3O)O)O[C@@H]3CO |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14247 | Deserpidine | Inquiry |
|
| PDP-17507 | Toonaciliatin M | Inquiry |
|
| PDP-18006 | Dihydroevocarpine | Inquiry |
|
| PDP-14113 | Isosilybin | Inquiry |
|
| PDP-14758 | Isovanillin | Inquiry |
|
| PDP-17883 | 2-epi-Cucurbitacin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
