25-O-Methylcimigenol-3-O-D-xylopyranoside | CAS | 27994-13-4 |
| Molecular Weight | 634.84 |
| Formula | C36H58O9 |
| SMILES | C[C@]12[C@@]3([H])[C@@]4(CC[C@@]1([C@]5([H])[C@]6(O[C@@H]([C@](C[C@H]5C)([H])O6)C(C)(C)OC)[C@@H]2O)C)[C@@]7([C@@](C(C)([C@H](CC7)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)C)([H])CC3)C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17680 | Salvileucalin A | Inquiry |
|
| PDP-18994 | Baicalein 7-O-β-D-ethylglucuronide | Inquiry |
|
| PDP-14383 | β-Apo-8'-carotenal | Inquiry |
|
| PDP-13627 | Helenalin | Inquiry |
|
| PDP-19852 | Vaccarin (Standard) | Inquiry |
|
| PDP-19854 | Oroxin B (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
