2',5,6',7-Tetraacetoxyflavanone | CAS | 80604-17-7 |
| Molecular Weight | 456.40 |
| Formula | C23H20O10 |
| SMILES | O=C1C[C@@H](C2=C(OC(C)=O)C=CC=C2OC(C)=O)OC3=CC(OC(C)=O)=CC(OC(C)=O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20123 | Colchiceine (Standard) | Inquiry |
|
| PDP-18502 | Jasminoside B | Inquiry |
|
| PDP-14804 | Benzoylhypaconine | Inquiry |
|
| PDP-20214 | Callistephin (chloride) (Standard) | Inquiry |
|
| PDP-17286 | 10α-Hydroxyepigambogic Acid | Inquiry |
|
| PDP-19868 | Homoplantaginin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
