(25R)-Spirost-4-ene-3,6,12-trione | CAS | 214681-62-6 |
| Molecular Weight | 440.57 |
| Formula | C27H36O5 |
| SMILES | C[C@@]12[C@]3([H])[C@](O[C@]4(CC[C@H](CO4)C)[C@H]3C)([H])C[C@@]1([H])[C@@]5([H])[C@]([C@@]6(C(C(C5)=O)=CC(CC6)=O)C)([H])CC2=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18731 | Combretol | Inquiry |
|
| PDP-19778 | Calceolarioside B (Standard) | Inquiry |
|
| PDP-13172 | Asiaticoside | Inquiry |
|
| PDP-19590 | 6-Dehydrogingerdione | Inquiry |
|
| PDP-16521 | Coptisine | Inquiry |
|
| PDP-14204 | Cyclogalegenin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
