3β-Hydroxylanosta-8,24-dien-21-al | CAS No. | 96574-03-7 |
| Purity | 98.46% |
| Molecular Weight | 440.70 |
| Formula | C30H48O2 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | C[C@]([C@@]12C)(CC[C@]1([H])[C@H](C=O)CC/C=C(C)/C)C(CC[C@@]3([H])C4(C)C)=C(CC2)[C@]3(CC[C@@H]4O)C |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10942 | β-Nicotinamide Mononucleotide | Inquiry |
|
| MDP-23796 | Napsamycin B | Inquiry |
|
| MDP-23378 | Maltol (Standard) | Inquiry |
|
| MDP-11792 | 2-Hydroxypalmitic Acid | Inquiry |
|
| MDP-24003 | Glucopiericidin B | Inquiry |
|
| MDP-11669 | Imidazoleacetic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
