3',4'-Dihydroxyflavone | Appearance | Solid |
| CAS | 4143-64-0 |
| Purity | 98.61% |
| Molecular Weight | 254.24 |
| Formula | C15H10O4 |
| Color | Off-white to light yellow |
| SMILES | O=C1C=C(C2=CC=C(O)C(O)=C2)OC3=CC=CC=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17824 | Majoranaquinone | Inquiry |
|
| PDP-18601 | (-)-Rabdosiin | Inquiry |
|
| PDP-17437 | Tuberculatin | Inquiry |
|
| PDP-16160 | Iristectorin B | Inquiry |
|
| PDP-16630 | Butyl Benzoate | Inquiry |
|
| PDP-14903 | Quassin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
