Iristectorin B | Appearance | Solid |
| CAS | 94396-09-5 |
| Purity | 99.94% |
| Molecular Weight | 492.43 |
| Formula | C23H24O12 |
| Color | White to off-white |
| SMILES | O=C1C(C2=CC=C(O)C(OC)=C2)=COC3=CC(O[C@@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)=C(OC)C(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19700 | Hydrocotoin | Inquiry |
|
| PDP-20298 | Angeloylgomisin Q | Inquiry |
|
| PDP-20231 | Kaempferol-3-O-[2″,6″-di-O-E-p-coumaroyl]-β-D-glucopyranoside | Inquiry |
|
| PDP-17796 | Sibiricine | Inquiry |
|
| PDP-19328 | Xanthoplanine | Inquiry |
|
| PDP-17231 | Geissoschizoline | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
