3,4-Dimethoxybenzamide (Standard) | CAS No. | 1521-41-1 |
| Molecular Weight | 181.19 |
| Formula | C9H11NO3 |
| SMILES | O=C(N)C1=CC=C(OC)C(OC)=C1 |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12158 | Nybomycin | Inquiry |
|
| MDP-22805 | 5'-Methylthioadenosine (Standard) | Inquiry |
|
| MDP-11836 | Maltoheptaose | Inquiry |
|
| MDP-23561 | 4-O-Demethyl-11-deoxydoxorubicin | Inquiry |
|
| MDP-22377 | K-13 | Inquiry |
|
| MDP-24035 | 2-Hydroxygentamicin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.