3',4',5',5,6,7-Hexamethoxyflavone | CAS | 29043-07-0 |
| Molecular Weight | 402.39 |
| Formula | C21H22O8 |
| SMILES | O=C1C=C(C2=CC(OC)=C(OC)C(OC)=C2)OC3=CC(OC)=C(OC)C(OC)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14324 | 3,5,7,3',4'-Pentamethoxyflavone | Inquiry |
|
| PDP-18349 | ent-17-Hydroxykaur-15-en-19-oic Acid | Inquiry |
|
| PDP-15807 | L-5-Hydroxytryptophan (Standard) | Inquiry |
|
| PDP-13585 | Parishin B | Inquiry |
|
| PDP-16702 | Loureirin C | Inquiry |
|
| PDP-18578 | Apigenin 7-O-sophoroside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
