L-5-Hydroxytryptophan (Standard) | Synonyms | L-5-HTP (Standard); Oxitriptan (Standard) |
| Appearance | Solid |
| CAS | 4350-09-8 |
| Molecular Weight | 220.22 |
| Formula | C11H12N2O3 |
| Color | Off-white to light brown |
| SMILES | N[C@@H](CC1=CNC2=CC=C(O)C=C12)C(O)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14338 | Robinetin | Inquiry |
|
| PDP-18927 | 6-Deoxyisojacareubin | Inquiry |
|
| PDP-19230 | Diselaginellin B | Inquiry |
|
| PDP-13978 | Lawsone Methyl Ether | Inquiry |
|
| PDP-20089 | Rhazimine | Inquiry |
|
| PDP-17742 | Diosgenin-3-O-rhamnosyl(1→2)[glucosyl(1→6)]glucoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
