4β-Hydroxywithanolide E | CAS | 54334-04-2 |
| Molecular Weight | 502.60 |
| Formula | C28H38O8 |
| SMILES | C[C@]1(C2=O)[C@@]3([C@H](C=C2)O)[C@](C[C@]([C@@]4(CC[C@](O)5[C@@](O)([C@@](OC6=O)([H])CC(C)=C6C)C)O)([H])[C@]1([H])CC[C@@]45C)([H])O3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19398 | Stauntosaponin A | Inquiry |
|
| PDP-20459 | Avicularin (Standard) | Inquiry |
|
| PDP-14801 | Notoginsenoside R2 | Inquiry |
|
| PDP-17918 | Rubelloside B | Inquiry |
|
| PDP-17889 | PD-1/PD-L1-IN-38 | Inquiry |
|
| PDP-13236 | Acacetin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.