Notoginsenoside R2 | Synonyms | 20(S)-Notoginsenoside R2; Ginsenoside Ng-R2 |
| Appearance | Solid |
| CAS | 80418-25-3 |
| Purity | 98.78% |
| Molecular Weight | 770.99 |
| Formula | C41H70O13 |
| Color | White to off-white |
| SMILES | C[C@]([C@@](C[C@H]1O)([H])[C@]2(CC[C@@H]3O)C)(C[C@H](O[C@@](O[C@H](CO)[C@@H](O)[C@@H]4O)([H])[C@@H]4O[C@@](OC[C@@H](O)[C@@H]5O)([H])[C@@H]5O)[C@@]2([H])C3(C)C)[C@]6([C@@]1([H])[C@]([C@@](C)(O)CC/C=C(C)/C)([H])CC6)C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15729 | S-(4-Hydroxybenzyl)glutathione | Inquiry |
|
| PDP-13412 | Isoacteoside | Inquiry |
|
| PDP-19705 | Derwentioside B | Inquiry |
|
| PDP-19838 | Hinokinin (Standard) | Inquiry |
|
| PDP-16526 | Nagilactone B | Inquiry |
|
| PDP-14834 | 20(R)-Ginsenoside Rh2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
