4-O-Beta-D-Glucopyranosyl-D-Glucitol
Catalog Number OM-5678
Product Name 4-O-Beta-D-Glucopyranosyl-D-Glucitol
CAS No. 535-94-4
| CAS No. | 535-94-4 |
| Molecular Formula | C12H24O11 |
| MW | 344.312 |
| Synonyms | 1,6-Anhydro-β-D-cellobiose |
| MDL | MFCD00676676 |
| SMILES | C([CH]1[CH]([CH]([CH]([CH](O1)O[CH]([CH](CO)O)[CH]([CH](CO)O)O)O)O)O)O |
| InchiKey | VQHSOMBJVWLPSR-UHFFFAOYSA-N |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5655 | 2-Deoxy-2-Fluoro-D-Glucose | Inquiry |
|
| OM-5287 | Saccharin | Inquiry |
|
| OM-5383 | D(+)-Raffinose Pentahydrate | Inquiry |
|
| OM-5434 | D-Lactose Monohydrate | Inquiry |
|
| OM-5526 | β-Cellobiosyl Azide | Inquiry |
|
| OM-5704 | Rutinose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.