4-O-Methylepisappanol | CAS | 112529-37-0 |
| Molecular Weight | 318.32 |
| Formula | C17H18O6 |
| SMILES | OC1=CC=C(C[C@@]2(COC3=CC(O)=CC=C3[C@@H]2OC)O)C=C1O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17212 | 6β,7β-Epoxyasteriscunolide A | Inquiry |
|
| PDP-18846 | Bletilloside A | Inquiry |
|
| PDP-19625 | Agavoside C' | Inquiry |
|
| PDP-13410 | Butein | Inquiry |
|
| PDP-17664 | Eudebeiolide B | Inquiry |
|
| PDP-16055 | Chelerythrine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
