Agavoside C' | CAS | 58546-17-1 |
| Molecular Weight | 1049.16 |
| Formula | C50H80O23 |
| SMILES | [H][C@]1(O[C@@]2(OC[C@H](C)CC2)[C@@H](C)[C@@]1([C@]34C)[H])C[C@@]3([H])[C@]5([H])CC[C@@]6([H])C[C@@H](O[C@H]7[C@@H]([C@H]([C@H]([C@@H](CO)O7)O[C@H]8[C@@H]([C@H]([C@@H]([C@@H](CO)O8)O[C@H]9[C@@H]([C@H]([C@@H]([C@@H](CO)O9)O)O)O[C@H]%10[C@@H]([C@H]([C@@H](CO%10)O)O)O)O)O)O)O)CC[C@]6(C)[C@@]5([H])CC4=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19864 | Ganoderic Acid D (Standard) | Inquiry |
|
| PDP-14437 | Strictosamide | Inquiry |
|
| PDP-14195 | Estragole | Inquiry |
|
| PDP-17387 | β-Acids Colupulone | Inquiry |
|
| PDP-19706 | Byzantionoside B | Inquiry |
|
| PDP-13961 | Hydroquinidine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.