4,4'-Dimethoxychalcone | Appearance | Solid |
| CAS | 2373-89-9 |
| Purity | 99.57% |
| Molecular Weight | 268.31 |
| Formula | C17H16O3 |
| Color | Light yellow to yellow |
| SMILES | O=C(C1=CC=C(OC)C=C1)/C=C/C2=CC=C(OC)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13206 | Benzo[a]pyrene | Inquiry |
|
| PDP-20427 | Gambogic Acid (Standard) | Inquiry |
|
| PDP-17556 | Acetyllycoposerramine M | Inquiry |
|
| PDP-19026 | Kanshone B | Inquiry |
|
| PDP-16314 | Eupalinolide K | Inquiry |
|
| PDP-13995 | Desmethoxyyangonin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
