5,7-Dimethoxyluteolin | Appearance | Solid |
| CAS | 90363-40-9 |
| Purity | 99.47% |
| Molecular Weight | 314.29 |
| Formula | C17H14O6 |
| Color | White to light yellow |
| SMILES | O=C1C=C(C2=CC=C(O)C(O)=C2)OC3=CC(OC)=CC(OC)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19681 | trans-Nerolidol (Standard) | Inquiry |
|
| PDP-20509 | Corilagin (Standard) | Inquiry |
|
| PDP-18174 | (E)-Methyl 3,4,5-trimethoxycinnamate | Inquiry |
|
| PDP-16076 | Taccalonolide B | Inquiry |
|
| PDP-17620 | AH13 | Inquiry |
|
| PDP-17955 | 2,3-Dihydropodocarpusflavone A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
