5,7,3'-Trihydroxy-6,4',5'-trimethoxyflavone | Appearance | Solid |
| CAS | 78417-26-2 |
| Purity | 99.82% |
| Molecular Weight | 360.31 |
| Formula | C18H16O8 |
| Color | Off-white to light yellow |
| SMILES | OC1=C2C(OC(C3=CC(OC)=C(OC)C(O)=C3)=CC2=O)=CC(O)=C1OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17226 | Grosshemin | Inquiry |
|
| PDP-15562 | Iristectorigenin B | Inquiry |
|
| PDP-18494 | 1,2,3,7-Tetramethoxyxanthone | Inquiry |
|
| PDP-20155 | Panaxatriol (Standard) | Inquiry |
|
| PDP-15464 | Ethyl Rosmarinate | Inquiry |
|
| PDP-15378 | Decursinol Angelate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
