2-8ºC, shun light.
6-Azido-6-Deoxy-D-Galactopyranose
Catalog Number OM-5639
Product Name 6-Azido-6-Deoxy-D-Galactopyranose
CAS No. 66927-03-5
Size 50 mg; 250 mg;
Aspect Powder
| CAS No. | 66927-03-5 |
| Molecular Formula | C6H11N3O5 |
| MW | 205.17 |
| Melting Point | 144-145ºC(lit.) |
| Application | Commonly used sugar synthesis intermediates. |
| Synonyms | 6-Azido-6-deoxy-D-galactose |
| MDL | MFCD03265529 |
| Safety Description | S36/37 |
| R-phrases | R20/21/22 |
| SMILES | C(C(C(C(C(C=O)O)O)O)O)N=[N+]=[N-] |
| InchiKey | HEYJIJWKSGKYTQ-UHFFFAOYSA-N |
2-8ºC, shun light.
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5442 | Sucrose | Inquiry |
|
| OM-5312 | 4-O-Benzyl-D-Glucal | Inquiry |
|
| OM-5686 | D-(+)-Cellopentaose | Inquiry |
|
| OM-5378 | Arabinose | Inquiry |
|
| OM-5787 | 1,3,4,6-Tetra-O-Acetyl-Beta-D-Mannopyranose | Inquiry |
|
| OM-5498 | P-Nitrophenyl Alpha-D-Xylopyranoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.