6-(γ,γ-Dimethylallylamino)purine (Standard) | CAS No. | 2365-40-4 |
| Molecular Weight | 203.24 |
| Formula | C10H13N5 |
| SMILES | C/C(C)=C/CNC1=C2N=CNC2=NC=N1 |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22018 | Maydispenoid B | Inquiry |
|
| MDP-22694 | Vanillin Acetate (Standard) | Inquiry |
|
| MDP-11429 | Inulin | Inquiry |
|
| MDP-22160 | Petunidin Chloride (Standard) | Inquiry |
|
| MDP-11065 | Quinolinic Acid | Inquiry |
|
| MDP-23612 | Clavariopsin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
