Under inert gas (nitrogen or argon) at 2-8ºC.
6-Monodeoxy-6-Monoamino-Beta-Cyclodextrine
Catalog Number OM-5799
Product Name 6-Monodeoxy-6-Monoamino-Beta-Cyclodextrine
CAS No. 29390-67-8
Size 100 mg; 250 mg; 1 g;
Aspect Off white solid
| CAS No. | 29390-67-8 |
| Molecular Formula | C42H71NO34 |
| MW | 1134 |
| Melting Point | 203ºC(lit.) |
| Boiling Point | 1527.8±60.0ºC(lit.) |
| Application | A cyclodextrin derivative that can be used to prepare other cyclodextrin derivatives. |
| Solubility | Soluble in water. |
| Synonyms | 6-amino-6-deoxy-β-cyclodextrin, monoamino betacyclodextrin |
| MDL | MFCD03452964 |
| SMILES | C(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(O2)C(C8O)O)CO)CO)CO)CO)CO)CO)O)O)N |
| InchiKey | OZBFLQITCMCIOY-UHFFFAOYSA-N |
Under inert gas (nitrogen or argon) at 2-8ºC.
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5489 | 3-O-Acetyl-1,2:5,6-Di-O-Isopropylidene-α-D-Galactofuranose | Inquiry |
|
| OM-5343 | Alpha-D-Ribofuranose | Inquiry |
|
| OM-5694 | D-Melezitose Dihydrate | Inquiry |
|
| OM-5307 | Ac4GlcNAlk | Inquiry |
|
| OM-5678 | 4-O-Beta-D-Glucopyranosyl-D-Glucitol | Inquiry |
|
| OM-5268 | Dextran T1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.