AA-57 | CAS No. | 68026-87-9 |
| Molecular Weight | 312.75 |
| Formula | C15H17ClO5 |
| SMILES | ClC[C@@]1([C@@]23[C@](COC1=O)([H])C(C(O)=O)=C[C@]2([H])[C@@H](C)C(C)=C3)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22388 | Deoxynivalenol (Standard) | Inquiry |
|
| MDP-23042 | Cyclo(D-Phe-L-Pro) | Inquiry |
|
| MDP-23892 | Cephamycin B | Inquiry |
|
| MDP-23054 | Cyclo(Tyr-Hpro) | Inquiry |
|
| MDP-22243 | (−)-Rugulosin | Inquiry |
|
| MDP-23947 | Manumycin E | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
