Acacetin-7-O-β-D-galactopyranoside | Appearance | Solid |
| CAS | 80443-15-8 |
| Purity | 98.57% |
| Molecular Weight | 446.40 |
| Formula | C22H22O10 |
| Color | White to off-white |
| SMILES | O=C1C2=C(O)C=C(O[C@@H]3O[C@@H]([C@@H]([C@@H]([C@H]3O)O)O)CO)C=C2OC(C4=CC=C(C=C4)OC)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14551 | Grosvenorine | Inquiry |
|
| PDP-14503 | Protosappanin B | Inquiry |
|
| PDP-17821 | Yemuoside YM12 | Inquiry |
|
| PDP-16897 | Pancratistatin | Inquiry |
|
| PDP-20187 | Cyanidin 3-sambubioside (chloride) (Standard) | Inquiry |
|
| PDP-16863 | Cristacarpin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
