Protosappanin B | Synonyms | (-)-Protosappanin B |
| Appearance | Solid |
| CAS | 102036-29-3 |
| Purity | 99.46% |
| Molecular Weight | 304.29 |
| Formula | C16H16O6 |
| Color | Light yellow to orange |
| SMILES | OC1=CC=C2C(OC[C@@](O)(CO)CC3=CC(O)=C(O)C=C23)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17387 | β-Acids Colupulone | Inquiry |
|
| PDP-20364 | Floramultine | Inquiry |
|
| PDP-15322 | 8-Epiloganic Acid | Inquiry |
|
| PDP-20306 | (+)-Intermedine (Standard) | Inquiry |
|
| PDP-18012 | Neocnidilide | Inquiry |
|
| PDP-18704 | Gnetulin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
