Acetyltrialanine | CAS No. | 19245-85-3 |
| Molecular Weight | 273.29 |
| Formula | C11H19N3O5 |
| SMILES | C[C@H](NC([C@@H](NC([C@@H](NC(C)=O)C)=O)C)=O)C(O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23187 | Decatromicin B | Inquiry |
|
| MDP-23512 | Aggreceride B | Inquiry |
|
| MDP-22133 | Aphidicolin (Standard) | Inquiry |
|
| MDP-12045 | Citronellyl Acetate | Inquiry |
|
| MDP-23287 | Fidaxomicin (Standard) | Inquiry |
|
| MDP-23592 | Deoxyfrenolicin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
