Adenosylcobalamin | CAS No. | 13870-90-1 |
| Purity | 98.80% |
| Synonyms | Coenzyme B12; Cobamamide; AdoCbl |
| Molecular Weight | 1579.58 |
| Formula | C72H100CoN18O17P |
| Appearance | Solid |
| Color | Brown to red |
| SMILES | O[C@@H]1[C@H](O[C@@H](N2C3=NC=NC(N)=C3N=C2)[C@@H]1O)[CH2-][Co+3]456([N]7=CN([C@@H](O[C@H](CO)[C@H]8OP9([O-])=O)[C@]8([H])O)C%10=CC(C)=C(C)C=C7%10)[N]%11=C%12[C@@H](CCC(N)=O)[C@@](CC(N)=O)(C)[C@]%11(C)[C@]([C@H](CC(N)=O)[C@]%13(CCC(NC[C@@H](C)O9)=O)C)([H])[N-]4C%13=C(C)C([C@@H](CCC(N)=O)C%14(C)C)=[N]5C%14=CC%15=[N]6C([C@](CC(N)=O)(C)[C@@H]%15CCC(N)=O)=C%12C |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11206 | Doxorubicin (hydrochloride) (Standard) | Inquiry |
|
| MDP-23450 | Ashimycin B | Inquiry |
|
| MDP-11622 | Aminomalonic Acid | Inquiry |
|
| MDP-23067 | Vibralactone B | Inquiry |
|
| MDP-21993 | Pyridomycin | Inquiry |
|
| MDP-23148 | Remisporine B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.