Ashimycin B | CAS No. | 123482-12-2 |
| Molecular Weight | 639.61 |
| Formula | C23H41N7O14 |
| SMILES | O[C@H]1[C@H](O[C@@H]2O[C@@H](C)[C@@](C=O)(O)[C@H]2O[C@H]3[C@@H](N(C)C(CO)=O)[C@@H]([C@@H](O)[C@H](CO)O3)O)[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@@H]1O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22185 | (E/Z)-Farnesyl Pyrophosphate | Inquiry |
|
| MDP-21978 | (22S,24E)-3β,22-Diacetoxylanosta-7,9(11),24-trien-26-oic Acid | Inquiry |
|
| MDP-11192 | Selenomethionine | Inquiry |
|
| MDP-23667 | Chymostatin C | Inquiry |
|
| MDP-24064 | Nanaomycin B | Inquiry |
|
| MDP-24012 | Pyripyropene B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
