Aeruginosin B | CAS No. | 6508-65-2 |
| Molecular Weight | 333.32 |
| Formula | C14H11N3O5S |
| SMILES | O=S(C1=CC2=C(N=C3C=CC(N)=CC3=[N+]2C)C(C(O)=O)=C1)([O-])=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22971 | Kinamycin B | Inquiry |
|
| MDP-23578 | 2-Hydroxyaclacinomycin B | Inquiry |
|
| MDP-21884 | Ustusolate C | Inquiry |
|
| MDP-24254 | Cedarmycin A | Inquiry |
|
| MDP-22318 | Norharmane (Standard) | Inquiry |
|
| MDP-22333 | Laureatin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
